Products 1072951-68-8

CAS 1072951-68-8 appears in our catalog under these names: 3,5-Diformyl-2-isopropoxyphenylboronic acid, 95%, 3,5-Diformyl-2-isopropoxyphenylboronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid (CAS 1072951-68-8) is a chemical compound with the molecular formula C11H13BO5 and a molecular weight of 236.03 g/mol. IUPAC name: (3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: MZTOPIAFLPHQPO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BO5
Molecular weight236.03 g/mol
IUPAC name(3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid
InChIKeyMZTOPIAFLPHQPO-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1OC(C)C)C=O)C=O)(O)O

Computed by PubChem (NCBI)