CAS 1072951-68-8 appears in our catalog under these names: 3,5-Diformyl-2-isopropoxyphenylboronic acid, 95%, 3,5-Diformyl-2-isopropoxyphenylboronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g.
(3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid (CAS 1072951-68-8) is a chemical compound with the molecular formula C11H13BO5 and a molecular weight of 236.03 g/mol. IUPAC name: (3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: MZTOPIAFLPHQPO-UHFFFAOYSA-N.
| Molecular formula | C11H13BO5 |
|---|---|
| Molecular weight | 236.03 g/mol |
| IUPAC name | (3,5-diformyl-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | MZTOPIAFLPHQPO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC(C)C)C=O)C=O)(O)O |
Computed by PubChem (NCBI)