Products 1268390-34-6
CAS 1268390-34-6 is the registry number for Ethyl 2-((1-hydroxy-1,3-dihydrobenzo[c][1,2]oxaborol-6-yl)oxy)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate (CAS 1268390-34-6) is a chemical compound with the molecular formula C11H13BO5 and a molecular weight of 236.03 g/mol. IUPAC name: ethyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate. InChIKey: NOTITTUZUQOGDV-UHFFFAOYSA-N.
| Molecular formula | C11H13BO5 |
|---|---|
| Molecular weight | 236.03 g/mol |
| IUPAC name | ethyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
| InChIKey | NOTITTUZUQOGDV-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)OCC(=O)OCC)O |
Computed by PubChem (NCBI)