CAS 1072952-27-2 is the registry number for 2,6-Difluoropyridine-3-boronic acid hydrate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
(2,6-difluoro-3-pyridinyl)boronic acid;hydrate (CAS 1072952-27-2) is a chemical compound with the molecular formula C5H6BF2NO3 and a molecular weight of 176.92 g/mol. IUPAC name: (2,6-difluoro-3-pyridinyl)boronic acid;hydrate. InChIKey: UROAWUNJFURWIY-UHFFFAOYSA-N.
| Molecular formula | C5H6BF2NO3 |
|---|---|
| Molecular weight | 176.92 g/mol |
| IUPAC name | (2,6-difluoro-3-pyridinyl)boronic acid;hydrate |
| InChIKey | UROAWUNJFURWIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)F)F)(O)O.O |
Computed by PubChem (NCBI)