Products 2377606-43-2

CAS 2377606-43-2 appears in our catalog under these names: 3,5-Difluoropyridine-4-boronic acid hydrate, 96%, (3,5-Difluoropyridin-4-yl)boronic acid hydrate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-pyridinyl)boronic acid;hydrate (CAS 2377606-43-2) is a chemical compound with the molecular formula C5H6BF2NO3 and a molecular weight of 176.92 g/mol. IUPAC name: (3,5-difluoro-4-pyridinyl)boronic acid;hydrate. InChIKey: OBPSIAAOXPAATC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6BF2NO3
Molecular weight176.92 g/mol
IUPAC name(3,5-difluoro-4-pyridinyl)boronic acid;hydrate
InChIKeyOBPSIAAOXPAATC-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1F)F)(O)O.O

Computed by PubChem (NCBI)