Products 1072952-40-9

CAS 1072952-40-9 is the registry number for 3-Picoline-4-boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(3-methyl-4-pyridinyl)boronic acid;hydrochloride (CAS 1072952-40-9) is a chemical compound with the molecular formula C6H9BClNO2 and a molecular weight of 173.41 g/mol. IUPAC name: (3-methyl-4-pyridinyl)boronic acid;hydrochloride. InChIKey: NGOUFMIMHSRFGU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BClNO2
Molecular weight173.41 g/mol
IUPAC name(3-methyl-4-pyridinyl)boronic acid;hydrochloride
InChIKeyNGOUFMIMHSRFGU-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1)C)(O)O.Cl

Computed by PubChem (NCBI)