Products 2096333-73-0

CAS 2096333-73-0 appears in our catalog under these names: 2-Methylpyridine-5-boronic acid hydrochloride, 98%, 6-Methylpyridine-3-boronic acid hydrochloride, 98%, 6-Methylpyridine-3-boronic acid hydrochloride, 2-Methylpyridine-5-boronic Acid Hydrochloride (contains varying amounts of Anhydride), 2-Methylpyridine-5-boronic acid, HCl, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(6-methyl-3-pyridinyl)boronic acid;hydrochloride (CAS 2096333-73-0) is a chemical compound with the molecular formula C6H9BClNO2 and a molecular weight of 173.41 g/mol. IUPAC name: (6-methyl-3-pyridinyl)boronic acid;hydrochloride. InChIKey: HBEJHFSGVGEQSH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BClNO2
Molecular weight173.41 g/mol
IUPAC name(6-methyl-3-pyridinyl)boronic acid;hydrochloride
InChIKeyHBEJHFSGVGEQSH-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)C)(O)O.Cl

Computed by PubChem (NCBI)