CAS 1073055-69-2 appears in our catalog under these names: (4-(Aminomethyl)-3-fluorophenyl)boronic acid, 97%, (4-(Aminomethyl)-3-fluorophenyl)boronic acid, 97%(HPLC),RG, 97%(HPLC),RG. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25mg, 100mg, 250mg.
[4-(aminomethyl)-3-fluorophenyl]boronic acid (CAS 1073055-69-2) is a chemical compound with the molecular formula C7H9BFNO2 and a molecular weight of 168.96 g/mol. IUPAC name: [4-(aminomethyl)-3-fluorophenyl]boronic acid. InChIKey: BUOUATUDGNOYMP-UHFFFAOYSA-N.
| Molecular formula | C7H9BFNO2 |
|---|---|
| Molecular weight | 168.96 g/mol |
| IUPAC name | [4-(aminomethyl)-3-fluorophenyl]boronic acid |
| InChIKey | BUOUATUDGNOYMP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN)F)(O)O |
Computed by PubChem (NCBI)