Products 2225171-71-9
CAS 2225171-71-9 is the registry number for 2–Fluoro–6–(ethyl–d5)–pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-fluoro-6-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid (CAS 2225171-71-9) is a chemical compound with the molecular formula C7H9BFNO2 and a molecular weight of 173.99 g/mol. IUPAC name: [2-fluoro-6-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid. InChIKey: ZVUBLOLPMYVRLG-ZBJDZAJPSA-N.
| Molecular formula | C7H9BFNO2 |
|---|---|
| Molecular weight | 173.99 g/mol |
| IUPAC name | [2-fluoro-6-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid |
| InChIKey | ZVUBLOLPMYVRLG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC(=CC(=C1)B(O)O)F |
Computed by PubChem (NCBI)