CAS 1073062-42-6 appears in our catalog under these names: 2–(3–Bromo–5–chlorophenyl)–4,6–diphenyl–1,3,5–triazine, 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 97%, 97%, 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 1073062-42-6) is a chemical compound with the molecular formula C21H13BrClN3 and a molecular weight of 422.7 g/mol. IUPAC name: 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: BLKKWMCDZNDYEQ-UHFFFAOYSA-N.
| Molecular formula | C21H13BrClN3 |
|---|---|
| Molecular weight | 422.7 g/mol |
| IUPAC name | 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | BLKKWMCDZNDYEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=CC(=C3)Br)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)