CAS 2425604-94-8 is the registry number for 2-(4-Bromo-3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 2425604-94-8) is a chemical compound with the molecular formula C21H13BrClN3 and a molecular weight of 422.7 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: FUUMFLBQPNHSNF-UHFFFAOYSA-N.
| Molecular formula | C21H13BrClN3 |
|---|---|
| Molecular weight | 422.7 g/mol |
| IUPAC name | 2-(4-bromo-3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | FUUMFLBQPNHSNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=C(C=C3)Br)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)