CAS 1073231-99-8 is the registry number for Tamsulosin Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-5-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]benzenesulfonamide (CAS 1073231-99-8) is a chemical compound with the molecular formula C18H24N2O3S and a molecular weight of 348.5 g/mol. IUPAC name: 2-methoxy-5-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]benzenesulfonamide. InChIKey: XRWQXURPDHPHTH-KBPBESRZSA-N.
| Molecular formula | C18H24N2O3S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 2-methoxy-5-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]benzenesulfonamide |
| InChIKey | XRWQXURPDHPHTH-KBPBESRZSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)N)N[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)