Products 17822-61-6
CAS 17822-61-6 is the registry number for Anticancer agent 237. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1-adamantyl)-3-(4-methylphenyl)sulfonylurea (CAS 17822-61-6) is a chemical compound with the molecular formula C18H24N2O3S and a molecular weight of 348.5 g/mol. IUPAC name: 1-(1-adamantyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: HGCUKZACTCRRHD-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O3S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 1-(1-adamantyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | HGCUKZACTCRRHD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)