Products 1073244-89-9
CAS 1073244-89-9 is the registry number for (Rac)-Normetanephrine-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol (CAS 1073244-89-9) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 186.22 g/mol. IUPAC name: 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol. InChIKey: YNYAYWLBAHXHLL-VWTWQGAWSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol |
| InChIKey | YNYAYWLBAHXHLL-VWTWQGAWSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC(=C(C=C1)O)OC)O)N |
Computed by PubChem (NCBI)