CAS 1073355-16-4 appears in our catalog under these names: 3-Benzyloxy-4-methoxycarbonylphenylboronic acid, pinacol ester, 95%, Methyl 2-(benzyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1073355-16-4) is a chemical compound with the molecular formula C21H25BO5 and a molecular weight of 368.2 g/mol. IUPAC name: methyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: PBHDAXIPBGMAKU-UHFFFAOYSA-N.
| Molecular formula | C21H25BO5 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | methyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | PBHDAXIPBGMAKU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)