CAS 2484920-08-1 is the registry number for Methyl 3-[2-methoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (CAS 2484920-08-1) is a chemical compound with the molecular formula C21H25BO5 and a molecular weight of 368.2 g/mol. IUPAC name: methyl 3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate. InChIKey: MZEJLGQGLFPZKN-UHFFFAOYSA-N.
| Molecular formula | C21H25BO5 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | methyl 3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| InChIKey | MZEJLGQGLFPZKN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)C3=CC(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)