CAS 1073371-73-9 is the registry number for 4-(Hydroxy(thiazol-2-yl)methyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(1,3-thiazol-2-yl)methanol (CAS 1073371-73-9) is a chemical compound with the molecular formula C16H20BNO3S and a molecular weight of 317.2 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(1,3-thiazol-2-yl)methanol. InChIKey: WLBDZEXNSNOBAQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(1,3-thiazol-2-yl)methanol |
| InChIKey | WLBDZEXNSNOBAQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C3=NC=CS3)O |
Computed by PubChem (NCBI)