CAS 1402227-63-7 is the registry number for 2-(4-Methoxyphenyl)thiazole-5-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1402227-63-7) is a chemical compound with the molecular formula C16H20BNO3S and a molecular weight of 317.2 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: SSTRIAOJMLFXFK-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | SSTRIAOJMLFXFK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)