Products 107348-49-2

CAS 107348-49-2 is the registry number for 4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid (CAS 107348-49-2) is a chemical compound with the molecular formula C11H15NO2S2 and a molecular weight of 257.4 g/mol. IUPAC name: 4-methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid. InChIKey: FCKSMEZVBFTODF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2S2
Molecular weight257.4 g/mol
IUPAC name4-methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid
InChIKeyFCKSMEZVBFTODF-UHFFFAOYSA-N
SMILESCC(C)(CCC(=O)O)SSC1=CC=CC=N1

Computed by PubChem (NCBI)