Products 91329-86-1
CAS 91329-86-1 is the registry number for 4-Tosylthiomorpholine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4-methylphenyl)sulfonylthiomorpholine (CAS 91329-86-1) is a chemical compound with the molecular formula C11H15NO2S2 and a molecular weight of 257.4 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonylthiomorpholine. InChIKey: VYFSCNGFRNWCEG-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S2 |
|---|---|
| Molecular weight | 257.4 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonylthiomorpholine |
| InChIKey | VYFSCNGFRNWCEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCSCC2 |
Computed by PubChem (NCBI)