CAS 1074-38-0 appears in our catalog under these names: 2–Nitro–5–methylpyridine, 5-Methyl-2-nitropyridine, >98.0%(GC), 5-Methyl-2-nitropyridine, 5-Methyl-2-nitropyridine 98%, 5-Methyl-2-nitropyridine, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 50g, 250g, 250mg.
5-methyl-2-nitropyridine (CAS 1074-38-0) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 5-methyl-2-nitropyridine. InChIKey: FISOVIVSROCTBV-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 5-methyl-2-nitropyridine |
| InChIKey | FISOVIVSROCTBV-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)