CAS 107517-28-2 appears in our catalog under these names: 1-(Chloromethyl)-2,6-dimethylnaphthalene, 95%, 1-(Chloromethyl)-2,6-dimethylnaphthalene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(chloromethyl)-2,6-dimethylnaphthalene (CAS 107517-28-2) is a chemical compound with the molecular formula C13H13Cl and a molecular weight of 204.69 g/mol. IUPAC name: 1-(chloromethyl)-2,6-dimethylnaphthalene. InChIKey: MDJOVYNQRMYHTN-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl |
|---|---|
| Molecular weight | 204.69 g/mol |
| IUPAC name | 1-(chloromethyl)-2,6-dimethylnaphthalene |
| InChIKey | MDJOVYNQRMYHTN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(C=C2)C)CCl |
Computed by PubChem (NCBI)