CAS 246874-31-7 is the registry number for 1-(Chloromethyl)-2,7-dimethylnaphthalene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(chloromethyl)-2,7-dimethylnaphthalene (CAS 246874-31-7) is a chemical compound with the molecular formula C13H13Cl and a molecular weight of 204.69 g/mol. IUPAC name: 1-(chloromethyl)-2,7-dimethylnaphthalene. InChIKey: KPYWNSLBZSNCAW-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl |
|---|---|
| Molecular weight | 204.69 g/mol |
| IUPAC name | 1-(chloromethyl)-2,7-dimethylnaphthalene |
| InChIKey | KPYWNSLBZSNCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC(=C2CCl)C |
Computed by PubChem (NCBI)