CAS 1075239-19-8 is the registry number for 5-(Hydroxymethyl)-N,N-dimethylpyrazole-1-sulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(hydroxymethyl)-N,N-dimethylpyrazole-1-sulfonamide (CAS 1075239-19-8) is a chemical compound with the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. IUPAC name: 5-(hydroxymethyl)-N,N-dimethylpyrazole-1-sulfonamide. InChIKey: RUJIYYYAZOMLLK-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O3S |
|---|---|
| Molecular weight | 205.24 g/mol |
| IUPAC name | 5-(hydroxymethyl)-N,N-dimethylpyrazole-1-sulfonamide |
| InChIKey | RUJIYYYAZOMLLK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C(=CC=N1)CO |
Computed by PubChem (NCBI)