CAS 349540-37-0 is the registry number for N,n-dimethyl-n′-(5-methyl-3-isoxazolyl)sulfamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(dimethylsulfamoylamino)-5-methyl-1,2-oxazole (CAS 349540-37-0) is a chemical compound with the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. IUPAC name: 3-(dimethylsulfamoylamino)-5-methyl-1,2-oxazole. InChIKey: QSZAGAIKVGQZBL-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O3S |
|---|---|
| Molecular weight | 205.24 g/mol |
| IUPAC name | 3-(dimethylsulfamoylamino)-5-methyl-1,2-oxazole |
| InChIKey | QSZAGAIKVGQZBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)N(C)C |
Computed by PubChem (NCBI)