Products 1075259-68-5
CAS 1075259-68-5 appears in our catalog under these names: 3-Bromo-6-methoxy-1,5-naphthyridin-4(1H)-one, 95%, 3-bromo-6-methoxy-1,4-dihydro-1,5-naphthyridin-4-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-6-methoxy-1H-1,5-naphthyridin-4-one (CAS 1075259-68-5) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 3-bromo-6-methoxy-1H-1,5-naphthyridin-4-one. InChIKey: UTGCNXFYKIPNJM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 3-bromo-6-methoxy-1H-1,5-naphthyridin-4-one |
| InChIKey | UTGCNXFYKIPNJM-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC=C(C2=O)Br |
Computed by PubChem (NCBI)