Products 1075720-65-8
CAS 1075720-65-8 is the registry number for 3-Hydroxy Cyproconazole. Offered by: TRC. Available pack sizes: 100mg.
2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butane-2,3-diol (CAS 1075720-65-8) is a chemical compound with the molecular formula C15H18ClN3O2 and a molecular weight of 307.77 g/mol. IUPAC name: 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butane-2,3-diol. InChIKey: NUFIGGFDCSFXQR-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O2 |
|---|---|
| Molecular weight | 307.77 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
| InChIKey | NUFIGGFDCSFXQR-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)(C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O)O |
Computed by PubChem (NCBI)