Products 3011836-40-8
CAS 3011836-40-8 is the registry number for CRBN ligand-198. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3-chloro-4-piperazin-1-ylphenyl)piperidine-2,6-dione (CAS 3011836-40-8) is a chemical compound with the molecular formula C15H18ClN3O2 and a molecular weight of 307.77 g/mol. IUPAC name: 3-(3-chloro-4-piperazin-1-ylphenyl)piperidine-2,6-dione. InChIKey: GVVQVYAOGICWEU-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O2 |
|---|---|
| Molecular weight | 307.77 g/mol |
| IUPAC name | 3-(3-chloro-4-piperazin-1-ylphenyl)piperidine-2,6-dione |
| InChIKey | GVVQVYAOGICWEU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=C(C=C2)N3CCNCC3)Cl |
Computed by PubChem (NCBI)