CAS 107610-69-5 is the registry number for tert-Butyl ((3R,4R)-4-methylpyrrolidin-3-yl)carbamate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate (CAS 107610-69-5) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate. InChIKey: BKITXDSDJGOXPN-SFYZADRCSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate |
| InChIKey | BKITXDSDJGOXPN-SFYZADRCSA-N |
| SMILES | C[C@@H]1CNC[C@@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)