CAS 127199-55-7 appears in our catalog under these names: (3R-cis)-(4-Methyl-3-pyrrolidinyl)-carbamic Acid 1,1-Dimethylethyl Ester, (3R,4R)–3–(Boc–amino)–4–methylpyrrolidine. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate (CAS 127199-55-7) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate. InChIKey: BKITXDSDJGOXPN-SFYZADRCSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-methylpyrrolidin-3-yl]carbamate |
| InChIKey | BKITXDSDJGOXPN-SFYZADRCSA-N |
| SMILES | C[C@@H]1CNC[C@@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)