CAS 1076197-55-1 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid, 95%, 4-Chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid, 95+%, 4-Chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid (CAS 1076197-55-1) is a chemical compound with the molecular formula C6H2ClF3N2O2 and a molecular weight of 226.54 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid. InChIKey: GMZOIVPQSFJUDK-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3N2O2 |
|---|---|
| Molecular weight | 226.54 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| InChIKey | GMZOIVPQSFJUDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)