Products 99368-67-9
CAS 99368-67-9 is the registry number for 2-CHLORO-5-NITRO-3-(TRIFLUOROMETHYL)PYRIDINE, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2-chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS 99368-67-9) is a chemical compound with the molecular formula C6H2ClF3N2O2 and a molecular weight of 226.54 g/mol. IUPAC name: 2-chloro-5-nitro-3-(trifluoromethyl)pyridine. InChIKey: OPEZLLCPUDLUFV-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3N2O2 |
|---|---|
| Molecular weight | 226.54 g/mol |
| IUPAC name | 2-chloro-5-nitro-3-(trifluoromethyl)pyridine |
| InChIKey | OPEZLLCPUDLUFV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)