CAS 1076198-09-8 appears in our catalog under these names: Glipizide EP Impurity J, Glipizide Impurity N, Ethyl 4-(b-(5-Methylpyrazine-2-carboxamido)ethyl)benzene Sulfonamide Carbamate, Ethyl 4-(beta-(5-Methylpyrazine-2-carboxamido)ethyl)benzene Sulfonamide Carbamate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
Ethyl N-[4-[2-[(5-methylpyrazine-2-carbonyl)amino]ethyl]phenyl]sulfonylcarbamate (CAS 1076198-09-8) is a chemical compound with the molecular formula C17H20N4O5S and a molecular weight of 392.4 g/mol. IUPAC name: ethyl N-[4-[2-[(5-methylpyrazine-2-carbonyl)amino]ethyl]phenyl]sulfonylcarbamate. InChIKey: IWLIZOPQUBXCKO-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O5S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | ethyl N-[4-[2-[(5-methylpyrazine-2-carbonyl)amino]ethyl]phenyl]sulfonylcarbamate |
| InChIKey | IWLIZOPQUBXCKO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NS(=O)(=O)C1=CC=C(C=C1)CCNC(=O)C2=NC=C(N=C2)C |
Computed by PubChem (NCBI)