CAS 89073-57-4 appears in our catalog under these names: 1,3-Dipropyl-8-p-sulfophenylxanthine, >95% (HPLC), 1,3-Dipropyl-8-p-sulfophenylxanthine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 2mg, 50mg.
4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid (CAS 89073-57-4) is a chemical compound with the molecular formula C17H20N4O5S and a molecular weight of 392.4 g/mol. IUPAC name: 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid. InChIKey: IWALGNIFYOBRKC-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O5S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid |
| InChIKey | IWALGNIFYOBRKC-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3=CC=C(C=C3)S(=O)(=O)O |
Computed by PubChem (NCBI)