Products 1076198-12-3
CAS 1076198-12-3 appears in our catalog under these names: Bupropion Impurity 28, 4-Fluoro bupropion. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg, 5mg.
2-(tert-butylamino)-1-(4-fluorophenyl)propan-1-one (CAS 1076198-12-3) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: 2-(tert-butylamino)-1-(4-fluorophenyl)propan-1-one. InChIKey: YTBHJXDTSQSFCF-UHFFFAOYSA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(4-fluorophenyl)propan-1-one |
| InChIKey | YTBHJXDTSQSFCF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)F)NC(C)(C)C |
Computed by PubChem (NCBI)