CAS 1076199-47-7 is the registry number for Citalopram Impurity 38. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoroacetamide (CAS 1076199-47-7) is a chemical compound with the molecular formula C20H16F4N2O2 and a molecular weight of 392.3 g/mol. IUPAC name: N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoroacetamide. InChIKey: WAXPNSRROUWKMK-UHFFFAOYSA-N.
| Molecular formula | C20H16F4N2O2 |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoroacetamide |
| InChIKey | WAXPNSRROUWKMK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C#N)C(O1)(CCCNC(=O)C(F)(F)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)