CAS 2416416-13-0 is the registry number for URAT1 inhibitor 11. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-fluoro-N-[6-(trifluoromethyl)quinolin-4-yl]anilino)butanoic acid (CAS 2416416-13-0) is a chemical compound with the molecular formula C20H16F4N2O2 and a molecular weight of 392.3 g/mol. IUPAC name: 4-(3-fluoro-N-[6-(trifluoromethyl)quinolin-4-yl]anilino)butanoic acid. InChIKey: BVVDLPLAZBSEIX-UHFFFAOYSA-N.
| Molecular formula | C20H16F4N2O2 |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | 4-(3-fluoro-N-[6-(trifluoromethyl)quinolin-4-yl]anilino)butanoic acid |
| InChIKey | BVVDLPLAZBSEIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N(CCCC(=O)O)C2=C3C=C(C=CC3=NC=C2)C(F)(F)F |
Computed by PubChem (NCBI)