Products 107622-80-0
CAS 107622-80-0 appears in our catalog under these names: 4-Phenoxybenzylamine, 98%, 4-Phenoxybenzylamine/ 98%, 4–Phenoxybenzylamine, 4-Phenoxybenzylamine, 4-Phenoxybenzylamine, >98.0%(GC). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 500mg, 0,01kg, 10g.
(4-phenoxyphenyl)methanamine (CAS 107622-80-0) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: (4-phenoxyphenyl)methanamine. InChIKey: CCAZAGUSBMVSAR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | (4-phenoxyphenyl)methanamine |
| InChIKey | CCAZAGUSBMVSAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)