Products 1076225-26-7
CAS 1076225-26-7 appears in our catalog under these names: (Rac)-PF-998425, (rac)–PF–998425, (Rac)-PF-998425, 99.68%, (Rac)-PF-998425, 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 5mg, 100 mg, 50 mg, 10mM/1mL, 5 mg, 10 mg.
4-(2-hydroxycyclohexyl)-2-(trifluoromethyl)benzonitrile (CAS 1076225-26-7) is a chemical compound with the molecular formula C14H14F3NO and a molecular weight of 269.26 g/mol. IUPAC name: 4-(2-hydroxycyclohexyl)-2-(trifluoromethyl)benzonitrile. InChIKey: MENRRRXHFQYXDW-UHFFFAOYSA-N.
| Molecular formula | C14H14F3NO |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 4-(2-hydroxycyclohexyl)-2-(trifluoromethyl)benzonitrile |
| InChIKey | MENRRRXHFQYXDW-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C2=CC(=C(C=C2)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)