Products 2568364-67-8
CAS 2568364-67-8 is the registry number for 9-(Trifluoromethyl)-1,2,3,4,4a,5-hexahydro-6H-pyrido[1,2-a]quinolin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(trifluoromethyl)-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one (CAS 2568364-67-8) is a chemical compound with the molecular formula C14H14F3NO and a molecular weight of 269.26 g/mol. IUPAC name: 9-(trifluoromethyl)-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one. InChIKey: ORYUNUGKKHRJEC-UHFFFAOYSA-N.
| Molecular formula | C14H14F3NO |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 9-(trifluoromethyl)-1,2,3,4,4a,5-hexahydrobenzo[c]quinolizin-6-one |
| InChIKey | ORYUNUGKKHRJEC-UHFFFAOYSA-N |
| SMILES | C1CCN2C(C1)CC(=O)C3=C2C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)