Products 107688-86-8

CAS 107688-86-8 is the registry number for rac N-Methyl Atomoxetine Oxalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

N,N-dimethyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid (CAS 107688-86-8) is a chemical compound with the molecular formula C20H25NO5 and a molecular weight of 359.4 g/mol. IUPAC name: N,N-dimethyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid. InChIKey: BQLMLCNKORRMJU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H25NO5
Molecular weight359.4 g/mol
IUPAC nameN,N-dimethyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid
InChIKeyBQLMLCNKORRMJU-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1OC(CCN(C)C)C2=CC=CC=C2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)