CAS 69712-22-7 is the registry number for 1-(Bis(phenylmethyl)amino)-1-deoxy-D-fructose. Offered by: TRC. Available pack sizes: 1g, 250mg, 50mg.
(3S,4R,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one (CAS 69712-22-7) is a chemical compound with the molecular formula C20H25NO5 and a molecular weight of 359.4 g/mol. IUPAC name: (3S,4R,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one. InChIKey: UBEAYAXTJWERHS-VAMGGRTRSA-N.
| Molecular formula | C20H25NO5 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (3S,4R,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one |
| InChIKey | UBEAYAXTJWERHS-VAMGGRTRSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)