Products 107694-17-7
CAS 107694-17-7 is the registry number for Methyl acetylacetate-13C4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Methyl 3-oxo(1,2,3,4-13C4)butanoate (CAS 107694-17-7) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 120.09 g/mol. IUPAC name: methyl 3-oxo(1,2,3,4-13C4)butanoate. InChIKey: WRQNANDWMGAFTP-NDYLVSJFSA-N.
| Molecular formula | C5H8O3 |
|---|---|
| Molecular weight | 120.09 g/mol |
| IUPAC name | methyl 3-oxo(1,2,3,4-13C4)butanoate |
| InChIKey | WRQNANDWMGAFTP-NDYLVSJFSA-N |
| SMILES | CO[13C](=O)[13CH2][13C](=O)[13CH3] |
Computed by PubChem (NCBI)