CAS 107739-65-1 is the registry number for (2S,3S)-2-Amino-4,4,4-trifluoro-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2-amino-4,4,4-trifluoro-3-methylbutanoic acid (CAS 107739-65-1) is a chemical compound with the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. IUPAC name: (2S,3S)-2-amino-4,4,4-trifluoro-3-methylbutanoic acid. InChIKey: BAOLXXJPOPIBKA-HRFVKAFMSA-N.
| Molecular formula | C5H8F3NO2 |
|---|---|
| Molecular weight | 171.12 g/mol |
| IUPAC name | (2S,3S)-2-amino-4,4,4-trifluoro-3-methylbutanoic acid |
| InChIKey | BAOLXXJPOPIBKA-HRFVKAFMSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)