CAS 2350003-12-0 is the registry number for Ethyl (S)-2-amino-3,3,3-trifluoropropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S)-2-amino-3,3,3-trifluoropropanoate (CAS 2350003-12-0) is a chemical compound with the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. IUPAC name: ethyl (2S)-2-amino-3,3,3-trifluoropropanoate. InChIKey: CLPSWBHEWJZMBS-VKHMYHEASA-N.
| Molecular formula | C5H8F3NO2 |
|---|---|
| Molecular weight | 171.12 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3,3,3-trifluoropropanoate |
| InChIKey | CLPSWBHEWJZMBS-VKHMYHEASA-N |
| SMILES | CCOC(=O)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)