CAS 107785-63-7 is the registry number for Piperazine-1,4-diylbis((4-chlorophenyl)methanone), 95%. Offered by: AmBeed. Available pack sizes: 5g.
[4-(4-chlorobenzoyl)piperazin-1-yl]-(4-chlorophenyl)methanone (CAS 107785-63-7) is a chemical compound with the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.2 g/mol. IUPAC name: [4-(4-chlorobenzoyl)piperazin-1-yl]-(4-chlorophenyl)methanone. InChIKey: UXYNNMHHFGAVAK-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl2N2O2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [4-(4-chlorobenzoyl)piperazin-1-yl]-(4-chlorophenyl)methanone |
| InChIKey | UXYNNMHHFGAVAK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=C(C=C2)Cl)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)