CAS 819807-03-9 is the registry number for 2-(2,4-dichlorophenoxy)-N-(2-indol-3-ylethyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,4-dichlorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]acetamide (CAS 819807-03-9) is a chemical compound with the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.2 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]acetamide. InChIKey: QPCMAFJEEXEVMW-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl2N2O2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| InChIKey | QPCMAFJEEXEVMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)COC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)