Products 107804-48-8
CAS 107804-48-8 is the registry number for AA 193. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-3-phenyl-7,8-dihydrofuro[2,3-g][1,2]benzoxazole-7-carboxylic acid (CAS 107804-48-8) is a chemical compound with the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. IUPAC name: 5-chloro-3-phenyl-7,8-dihydrofuro[2,3-g][1,2]benzoxazole-7-carboxylic acid. InChIKey: RVKIPRIYUGLRFF-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO4 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | 5-chloro-3-phenyl-7,8-dihydrofuro[2,3-g][1,2]benzoxazole-7-carboxylic acid |
| InChIKey | RVKIPRIYUGLRFF-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C=C3C(=C21)ON=C3C4=CC=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)