Products 94205-22-8
CAS 94205-22-8 appears in our catalog under these names: Anticancer agent 93, Anticancer agent 93, 98.01%, Anticancer agent 93, 98%. Offered by: GLPBio, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
3-chloro-N-(4-hydroxy-2-oxochromen-3-yl)benzamide (CAS 94205-22-8) is a chemical compound with the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. IUPAC name: 3-chloro-N-(4-hydroxy-2-oxochromen-3-yl)benzamide. InChIKey: OLUXHDREXNYHFH-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO4 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | 3-chloro-N-(4-hydroxy-2-oxochromen-3-yl)benzamide |
| InChIKey | OLUXHDREXNYHFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)O2)NC(=O)C3=CC(=CC=C3)Cl)O |
Computed by PubChem (NCBI)