Products 1078123-69-9

CAS 1078123-69-9 is the registry number for Phenylmethyl N-1-propen-1-ylcarbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(E)-prop-1-enyl]carbamate (CAS 1078123-69-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: benzyl N-[(E)-prop-1-enyl]carbamate. InChIKey: QVMNEPDAKLAFOH-KRXBUXKQSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC namebenzyl N-[(E)-prop-1-enyl]carbamate
InChIKeyQVMNEPDAKLAFOH-KRXBUXKQSA-N
SMILESC/C=C/NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)