Products 1078166-36-5

CAS 1078166-36-5 is the registry number for Ethyl 3-(chloromethyl)azetidine-3-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-(chloromethyl)azetidine-3-carboxylate;hydrochloride (CAS 1078166-36-5) is a chemical compound with the molecular formula C7H13Cl2NO2 and a molecular weight of 214.09 g/mol. IUPAC name: ethyl 3-(chloromethyl)azetidine-3-carboxylate;hydrochloride. InChIKey: KWYWKRHTRGBKDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2NO2
Molecular weight214.09 g/mol
IUPAC nameethyl 3-(chloromethyl)azetidine-3-carboxylate;hydrochloride
InChIKeyKWYWKRHTRGBKDJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CNC1)CCl.Cl

Computed by PubChem (NCBI)